C17H15N — CID 71158878
(9R)-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,11,13(17),14-heptaene (PubChem CID 71158878) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is (9R)-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,11,13(17),14-heptaene.
| Compound Name | (9R)-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,11,13(17),14-heptaene |
|---|---|
| PubChem CID | 71158878 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (9R)-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,11,13(17),14-heptaene |
| SMILES | CN1c2ccccc2-c2cccc3c2[C@H]1CC=C3 |
| InChI | InChI=1S/C17H15N/c1-18-15-10-3-2-8-13(15)14-9-4-6-12-7-5-11-16(18)17(12)14/h2-10,16H,11H2,1H3/t16-/m1/s1 |
| InChIKey | QDSUELTXPLFXQA-MRXNPFEDSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |