C25H26F2N4O5S — CID 71158884
2-[3-(3,5-difluorophenyl)-1,5-dioxo-1,4-thiazinan-4-yl]-N-[(2R)-1',7-dimethyl-2',4'-dioxospiro[1,3,7,7a-tetrahydroindene-2,5'-imidazolidine]-5-yl]acetamide (PubChem CID 71158884) has the molecular formula C25H26F2N4O5S and a molecular weight of 532.57 g/mol. Its IUPAC name is 2-[3-(3,5-difluorophenyl)-1,5-dioxo-1,4-thiazinan-4-yl]-N-[(2R)-1',7-dimethyl-2',4'-dioxospiro[1,3,7,7a-tetrahydroindene-2,5'-imidazolidine]-5-yl]acetamide.
| Compound Name | 2-[3-(3,5-difluorophenyl)-1,5-dioxo-1,4-thiazinan-4-yl]-N-[(2R)-1',7-dimethyl-2',4'-dioxospiro[1,3,7,7a-tetrahydroindene-2,5'-imidazolidine]-5-yl]acetamide |
|---|---|
| PubChem CID | 71158884 |
| Molecular Formula | C25H26F2N4O5S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[3-(3,5-difluorophenyl)-1,5-dioxo-1,4-thiazinan-4-yl]-N-[(2R)-1',7-dimethyl-2',4'-dioxospiro[1,3,7,7a-tetrahydroindene-2,5'-imidazolidine]-5-yl]acetamide |
| SMILES | CC1C=C(NC(=O)CN2C(=O)CS(=O)CC2c2cc(F)cc(F)c2)C=C2C[C@]3(CC21)C(=O)NC(=O)N3C |
| InChI | InChI=1S/C25H26F2N4O5S/c1-13-3-18(6-15-8-25(9-19(13)15)23(34)29-24(35)30(25)2)28-21(32)10-31-20(11-37(36)12-22(31)33)14-4-16(26)7-17(27)5-14/h3-7,13,19-20H,8-12H2,1-2H3,(H,28,32)(H,29,34,35)/t13?,19?,20?,25-,37?/m0/s1 |
| InChIKey | SZIFQBYMZYETPQ-YEWOMLMFSA-N |
| XLogP | 1.50 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|