About 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine
5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine (PubChem CID 71159457) has the molecular formula C9H14F3NO2S
and a molecular weight of 257.28 g/mol. Its IUPAC name is 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 71159457 |
| Molecular Formula | C9H14F3NO2S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=CCCN(S(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO2S/c1-7(2)8-4-3-5-13(6-8)16(14,15)9(10,11)12/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | AMDSALANXOWNSR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine (CID 71159457) is 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine is CC(C)C1=CCCN(S(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine?
The InChIKey is AMDSALANXOWNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2S/c1-7(2)8-4-3-5-13(6-8)16(14,15)9(10,11)12/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine?
5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine has a molecular weight of 257.28 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1-(trifluoromethylsulfonyl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 71159457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).