C37H62O5 — CID 71159469
4-O-[(8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-(2-hydroxyhexyl) butanedioate (PubChem CID 71159469) has the molecular formula C37H62O5 and a molecular weight of 586.90 g/mol. Its IUPAC name is 4-O-[(8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-(2-hydroxyhexyl) butanedioate.
| Compound Name | 4-O-[(8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-(2-hydroxyhexyl) butanedioate |
|---|---|
| PubChem CID | 71159469 |
| Molecular Formula | C37H62O5 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.46 |
| IUPAC Name | 4-O-[(8S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-(2-hydroxyhexyl) butanedioate |
| SMILES | CCCCC(O)COC(=O)CCC(=O)OC1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C37H62O5/c1-7-8-12-28(38)24-41-34(39)17-18-35(40)42-29-19-21-36(5)27(23-29)13-14-30-32-16-15-31(26(4)11-9-10-25(2)3)37(32,6)22-20-33(30)36/h13,25-26,28-33,38H,7-12,14-24H2,1-6H3/t26-,28?,29?,30+,31-,32?,33?,36+,37-/m1/s1 |
| InChIKey | VACRSQVWFXDJFG-FAJBHXTASA-N |
| XLogP | 8.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|