C21H24N4O2 — CID 71159662
9-(4-hydroxy-2-methylanilino)-7-methyl-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 71159662) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 9-(4-hydroxy-2-methylanilino)-7-methyl-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-(4-hydroxy-2-methylanilino)-7-methyl-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 71159662 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 9-(4-hydroxy-2-methylanilino)-7-methyl-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cc(Nc2ccc(O)cc2C)c2nc(N3CCCCC3)cc(=O)n2c1 |
| InChI | InChI=1S/C21H24N4O2/c1-14-10-18(22-17-7-6-16(26)11-15(17)2)21-23-19(12-20(27)25(21)13-14)24-8-4-3-5-9-24/h6-7,10-13,22,26H,3-5,8-9H2,1-2H3 |
| InChIKey | QPCRZMINUPGBCL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|