C19H34F2O6 — CID 71160106
2,2-difluoro-2-[(2S,3R,4S,5R)-3,4,5-tributoxyoxan-2-yl]acetic acid (PubChem CID 71160106) has the molecular formula C19H34F2O6 and a molecular weight of 396.47 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2S,3R,4S,5R)-3,4,5-tributoxyoxan-2-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[(2S,3R,4S,5R)-3,4,5-tributoxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 71160106 |
| Molecular Formula | C19H34F2O6 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2,2-difluoro-2-[(2S,3R,4S,5R)-3,4,5-tributoxyoxan-2-yl]acetic acid |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@@H](C(F)(F)C(=O)O)OC[C@H]1OCCCC |
| InChI | InChI=1S/C19H34F2O6/c1-4-7-10-24-14-13-27-17(19(20,21)18(22)23)16(26-12-9-6-3)15(14)25-11-8-5-2/h14-17H,4-13H2,1-3H3,(H,22,23)/t14-,15+,16-,17+/m1/s1 |
| InChIKey | XAJGZQPJEKGYSB-TWMKSMIVSA-N |
| XLogP | 3.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|