C29H48F2O6 — CID 71160519
butyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate (PubChem CID 71160519) has the molecular formula C29H48F2O6 and a molecular weight of 530.69 g/mol. Its IUPAC name is butyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71160519 |
| Molecular Formula | C29H48F2O6 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | butyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCOC(=O)CCCCCC[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1CCC(=O)C(F)(F)CCCC |
| InChI | InChI=1S/C29H48F2O6/c1-3-5-18-29(30,31)26(33)17-16-23-22(13-9-7-8-10-14-27(34)35-19-6-4-2)24(32)21-25(23)37-28-15-11-12-20-36-28/h22-23,25,28H,3-21H2,1-2H3/t22-,23-,25-,28?/m1/s1 |
| InChIKey | ASJUYMBFIGVJKU-IHVGNTAMSA-N |
| XLogP | 6.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|