C34H40FNO6 — CID 71160778
(3R,4S)-1-(4-fluorophenyl)-3-[3-(4-propylphenyl)propyl]-4-[4-[[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one (PubChem CID 71160778) has the molecular formula C34H40FNO6 and a molecular weight of 577.69 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-propylphenyl)propyl]-4-[4-[[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-propylphenyl)propyl]-4-[4-[[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 71160778 |
| Molecular Formula | C34H40FNO6 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-propylphenyl)propyl]-4-[4-[[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one |
| SMILES | CCCc1ccc(CCC[C@H]2C(=O)N(c3ccc(F)cc3)[C@@H]2c2ccc(CC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C34H40FNO6/c1-2-4-21-7-9-22(10-8-21)5-3-6-27-30(36(34(27)41)26-17-15-25(35)16-18-26)24-13-11-23(12-14-24)19-28-31(38)33(40)32(39)29(20-37)42-28/h7-18,27-33,37-40H,2-6,19-20H2,1H3/t27-,28?,29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | SGXFDQPSFRPLGF-VGHGKKPLSA-N |
| XLogP | 3.89 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |