C24H27N2P — CID 71160832
(5aS,9aS)-4-naphthalen-2-yl-3-phenyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,5,3]diazaphosphepine (PubChem CID 71160832) has the molecular formula C24H27N2P and a molecular weight of 374.47 g/mol. Its IUPAC name is (5aS,9aS)-4-naphthalen-2-yl-3-phenyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,5,3]diazaphosphepine.
| Compound Name | (5aS,9aS)-4-naphthalen-2-yl-3-phenyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,5,3]diazaphosphepine |
|---|---|
| PubChem CID | 71160832 |
| Molecular Formula | C24H27N2P |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (5aS,9aS)-4-naphthalen-2-yl-3-phenyl-1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,5,3]diazaphosphepine |
| SMILES | c1ccc(P2CN[C@H]3CCCC[C@@H]3NC2c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H27N2P/c1-2-10-21(11-3-1)27-17-25-22-12-6-7-13-23(22)26-24(27)20-15-14-18-8-4-5-9-19(18)16-20/h1-5,8-11,14-16,22-26H,6-7,12-13,17H2/t22-,23-,24?,27?/m0/s1 |
| InChIKey | NBLSRADZSXETOB-KQNDRWHCSA-N |
| XLogP | 5.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|