C28H36N2O4 — CID 71161145
3-(2,4-dibutoxy-5-ethylphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazole (PubChem CID 71161145) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-(2,4-dibutoxy-5-ethylphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazole.
| Compound Name | 3-(2,4-dibutoxy-5-ethylphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 71161145 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 3-(2,4-dibutoxy-5-ethylphenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazole |
| SMILES | CCCCOc1cc(OCCCC)c(-c2n[nH]c(C)c2-c2ccc3c(c2)OCCO3)cc1CC |
| InChI | InChI=1S/C28H36N2O4/c1-5-8-12-31-24-18-25(32-13-9-6-2)22(16-20(24)7-3)28-27(19(4)29-30-28)21-10-11-23-26(17-21)34-15-14-33-23/h10-11,16-18H,5-9,12-15H2,1-4H3,(H,29,30) |
| InChIKey | WUKLCEXPVMBBII-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|