C13H19N5O4 — CID 71161667
(3R,4R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4,6-dimethyloxane-3,4-diol (PubChem CID 71161667) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is (3R,4R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4,6-dimethyloxane-3,4-diol.
| Compound Name | (3R,4R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 71161667 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (3R,4R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4,6-dimethyloxane-3,4-diol |
| SMILES | CC1OC(CO)[C@@H](O)[C@](C)(O)C1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H19N5O4/c1-6-9(13(2,21)10(20)7(3-19)22-6)18-5-17-8-11(14)15-4-16-12(8)18/h4-7,9-10,19-21H,3H2,1-2H3,(H2,14,15,16)/t6?,7?,9?,10-,13-/m1/s1 |
| InChIKey | XHROVBCRNOUZDU-QCLAXSCESA-N |
| XLogP | -1.16 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |