About 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile
4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile (PubChem CID 71161722) has the molecular formula C20H29F4NO
and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile |
| PubChem CID | 71161722 |
| Molecular Formula | C20H29F4NO |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(OC(F)(F)C2C(F)CC(C3CCCCC3)CC2F)CC1 |
| InChI | InChI=1S/C20H29F4NO/c21-17-10-15(14-4-2-1-3-5-14)11-18(22)19(17)20(23,24)26-16-8-6-13(12-25)7-9-16/h13-19H,1-11H2 |
| InChIKey | XNXAJCJCCAITDG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile?
The IUPAC name of 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile (CID 71161722) is 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile.
What is the SMILES notation for 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile?
The canonical SMILES for 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile is N#CC1CCC(OC(F)(F)C2C(F)CC(C3CCCCC3)CC2F)CC1.
What is the InChIKey of 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile?
The InChIKey is XNXAJCJCCAITDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F4NO/c21-17-10-15(14-4-2-1-3-5-14)11-18(22)19(17)20(23,24)26-16-8-6-13(12-25)7-9-16/h13-19H,1-11H2.
What are the key properties of 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile?
4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile has a molecular weight of 375.45 g/mol, XLogP of 5.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-cyclohexyl-2,6-difluorocyclohexyl)-difluoromethoxy]cyclohexane-1-carbonitrile is sourced from PubChem (CID 71161722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).