About 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide
5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 71162206) has the molecular formula C26H31N3O3
and a molecular weight of 433.55 g/mol. Its IUPAC name is 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide |
| PubChem CID | 71162206 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1C(=O)NC(Cc2ccccc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C26H31N3O3/c30-24(27-21-14-8-3-9-15-21)23-25(31)28-22(18-20-12-6-2-7-13-20)26(32)29(23)17-16-19-10-4-1-5-11-19/h1-2,4-7,10-13,21-23H,3,8-9,14-18H2,(H,27,30)(H,28,31) |
| InChIKey | DUMPUIUUZHJIAG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide?
The IUPAC name of 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide (CID 71162206) is 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide.
What is the SMILES notation for 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide?
The canonical SMILES for 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide is O=C(NC1CCCCC1)C1C(=O)NC(Cc2ccccc2)C(=O)N1CCc1ccccc1.
What is the InChIKey of 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide?
The InChIKey is DUMPUIUUZHJIAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3O3/c30-24(27-21-14-8-3-9-15-21)23-25(31)28-22(18-20-12-6-2-7-13-20)26(32)29(23)17-16-19-10-4-1-5-11-19/h1-2,4-7,10-13,21-23H,3,8-9,14-18H2,(H,27,30)(H,28,31).
What are the key properties of 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide?
5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide has a molecular weight of 433.55 g/mol, XLogP of 2.62, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-N-cyclohexyl-3,6-dioxo-1-(2-phenylethyl)piperazine-2-carboxamide is sourced from PubChem (CID 71162206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).