C10H19NO2S — CID 71162609
2-(sulfinoamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 71162609) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is 2-(sulfinoamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(sulfinoamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 71162609 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-(sulfinoamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | O=S(O)NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C10H19NO2S/c12-14(13)11-10-6-5-8-3-1-2-4-9(8)7-10/h8-11H,1-7H2,(H,12,13) |
| InChIKey | AAGVULJYZFXXDC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|