C17H33N3 — CID 71162733
2-[1-(2-methylbutan-2-yl)piperidin-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 71162733) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 2-[1-(2-methylbutan-2-yl)piperidin-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[1-(2-methylbutan-2-yl)piperidin-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 71162733 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 2-[1-(2-methylbutan-2-yl)piperidin-4-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCC(C)(C)N1CCC(N2CCN3CCCC3C2)CC1 |
| InChI | InChI=1S/C17H33N3/c1-4-17(2,3)20-10-7-15(8-11-20)19-13-12-18-9-5-6-16(18)14-19/h15-16H,4-14H2,1-3H3 |
| InChIKey | FXHJDHZKQJPPJX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |