About methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate
methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate (PubChem CID 7116289) has the molecular formula C7H10O4S
and a molecular weight of 190.22 g/mol. Its IUPAC name is methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate |
| PubChem CID | 7116289 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10O4S/c1-11-7(8)4-6-2-3-12(9,10)5-6/h2-3,6H,4-5H2,1H3/t6-/m1/s1 |
| InChIKey | IDNOEDBHBJKXPV-ZCFIWIBFSA-N |
| XLogP | 0.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate?
The IUPAC name of methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate (CID 7116289) is methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate?
The canonical SMILES for methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate is COC(=O)C[C@H]1C=CS(=O)(=O)C1.
What is the InChIKey of methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate?
The InChIKey is IDNOEDBHBJKXPV-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10O4S/c1-11-7(8)4-6-2-3-12(9,10)5-6/h2-3,6H,4-5H2,1H3/t6-/m1/s1.
What are the key properties of methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate?
methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate has a molecular weight of 190.22 g/mol, XLogP of 0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetate is sourced from PubChem (CID 7116289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).