C10H17N5O2S — CID 71162910
6-tert-butyl-3-[1-(sulfinoamino)ethyl]-5H-pyrazolo[5,1-c][1,2,4]triazole (PubChem CID 71162910) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 6-tert-butyl-3-[1-(sulfinoamino)ethyl]-5H-pyrazolo[5,1-c][1,2,4]triazole.
| Compound Name | 6-tert-butyl-3-[1-(sulfinoamino)ethyl]-5H-pyrazolo[5,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 71162910 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-tert-butyl-3-[1-(sulfinoamino)ethyl]-5H-pyrazolo[5,1-c][1,2,4]triazole |
| SMILES | CC(NS(=O)O)c1nnc2cc(C(C)(C)C)[nH]n12 |
| InChI | InChI=1S/C10H17N5O2S/c1-6(14-18(16)17)9-12-11-8-5-7(10(2,3)4)13-15(8)9/h5-6,13-14H,1-4H3,(H,16,17) |
| InChIKey | VPJCPALPAGNMPK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|