About 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol
1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol (PubChem CID 71163686) has the molecular formula C12H17F3O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol |
| PubChem CID | 71163686 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol |
| SMILES | CCCC(O)CC1C=C(C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C12H17F3O/c1-2-4-11(16)8-9-5-3-6-10(7-9)12(13,14)15/h3,6-7,9,11,16H,2,4-5,8H2,1H3 |
| InChIKey | LUHHZMAZMZDIPP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol?
The IUPAC name of 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol (CID 71163686) is 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol.
What is the SMILES notation for 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol?
The canonical SMILES for 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol is CCCC(O)CC1C=C(C(F)(F)F)C=CC1.
What is the InChIKey of 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol?
The InChIKey is LUHHZMAZMZDIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3O/c1-2-4-11(16)8-9-5-3-6-10(7-9)12(13,14)15/h3,6-7,9,11,16H,2,4-5,8H2,1H3.
What are the key properties of 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol?
1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol has a molecular weight of 234.26 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentan-2-ol is sourced from PubChem (CID 71163686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).