About (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol
(2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol (PubChem CID 71163756) has the molecular formula C11H16F2O
and a molecular weight of 202.24 g/mol. Its IUPAC name is (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol |
| PubChem CID | 71163756 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol |
| SMILES | CCC[C@H](O)C(F)(F)C1C=CC=CC1 |
| InChI | InChI=1S/C11H16F2O/c1-2-6-10(14)11(12,13)9-7-4-3-5-8-9/h3-5,7,9-10,14H,2,6,8H2,1H3/t9?,10-/m0/s1 |
| InChIKey | CJYMIDXHZOAYTH-AXDSSHIGSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol?
The IUPAC name of (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol (CID 71163756) is (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol.
What is the SMILES notation for (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol?
The canonical SMILES for (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol is CCC[C@H](O)C(F)(F)C1C=CC=CC1.
What is the InChIKey of (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol?
The InChIKey is CJYMIDXHZOAYTH-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H16F2O/c1-2-6-10(14)11(12,13)9-7-4-3-5-8-9/h3-5,7,9-10,14H,2,6,8H2,1H3/t9?,10-/m0/s1.
What are the key properties of (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol?
(2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol has a molecular weight of 202.24 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-cyclohexa-2,4-dien-1-yl-1,1-difluoropentan-2-ol is sourced from PubChem (CID 71163756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).