About 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol
1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol (PubChem CID 71163771) has the molecular formula C12H20Cl2O
and a molecular weight of 251.20 g/mol. Its IUPAC name is 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol.
Molecular Properties
| Compound Name | 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol |
| PubChem CID | 71163771 |
| Molecular Formula | C12H20Cl2O |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol |
| SMILES | CCCC(O)CC1C=C(Cl)[C@@](C)(Cl)CC1 |
| InChI | InChI=1S/C12H20Cl2O/c1-3-4-10(15)7-9-5-6-12(2,14)11(13)8-9/h8-10,15H,3-7H2,1-2H3/t9?,10?,12-/m0/s1 |
| InChIKey | MFOPVDNQYNTIHN-CBINBANVSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol?
The IUPAC name of 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol (CID 71163771) is 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol.
What is the SMILES notation for 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol?
The canonical SMILES for 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol is CCCC(O)CC1C=C(Cl)[C@@](C)(Cl)CC1.
What is the InChIKey of 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol?
The InChIKey is MFOPVDNQYNTIHN-CBINBANVSA-N. The full InChI is InChI=1S/C12H20Cl2O/c1-3-4-10(15)7-9-5-6-12(2,14)11(13)8-9/h8-10,15H,3-7H2,1-2H3/t9?,10?,12-/m0/s1.
What are the key properties of 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol?
1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol has a molecular weight of 251.20 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-3,4-dichloro-4-methylcyclohex-2-en-1-yl]pentan-2-ol is sourced from PubChem (CID 71163771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).