C19H17F3N4O — CID 71163877
6-methyl-4-[2-[[6-methyl-2-(2,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethyl]-1H-pyridin-2-one (PubChem CID 71163877) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is 6-methyl-4-[2-[[6-methyl-2-(2,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethyl]-1H-pyridin-2-one.
| Compound Name | 6-methyl-4-[2-[[6-methyl-2-(2,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71163877 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 6-methyl-4-[2-[[6-methyl-2-(2,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethyl]-1H-pyridin-2-one |
| SMILES | Cc1cc(NCCc2cc(C)[nH]c(=O)c2)nc(-c2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C19H17F3N4O/c1-10-5-12(7-18(27)24-10)3-4-23-17-6-11(2)25-19(26-17)13-8-15(21)16(22)9-14(13)20/h5-9H,3-4H2,1-2H3,(H,24,27)(H,23,25,26) |
| InChIKey | IZHUDNTURDVRBD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|