C19H27NO4 — CID 71164105
3-[(1R,3R,8R,10S,13S)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]propanenitrile (PubChem CID 71164105) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[(1R,3R,8R,10S,13S)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]propanenitrile.
| Compound Name | 3-[(1R,3R,8R,10S,13S)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]propanenitrile |
|---|---|
| PubChem CID | 71164105 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[(1R,3R,8R,10S,13S)-spiro[4,6,9,14-tetraoxatetracyclo[6.6.1.01,10.03,7]pentadecane-5,1'-cyclohexane]-13-yl]propanenitrile |
| SMILES | N#CCC[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@H]2OC4(CCCCC4)OC32)O1 |
| InChI | InChI=1S/C19H27NO4/c20-10-4-5-13-6-7-16-18(22-13)11-14(21-16)17-15(12-18)23-19(24-17)8-2-1-3-9-19/h13-17H,1-9,11-12H2/t13-,14+,15+,16-,17?,18+/m0/s1 |
| InChIKey | ZRYCKZWKHUFNPT-HZNOVYTPSA-N |
| XLogP | 3.21 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |