C23H38O7Si — CID 71164111
methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 71164111) has the molecular formula C23H38O7Si and a molecular weight of 454.64 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 71164111 |
| Molecular Formula | C23H38O7Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H](C(O)/C=C/[Si](C)(C)C)[C@H]3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C23H38O7Si/c1-26-18(25)14-15-8-9-17-20(27-15)22-21(29-23(30-22)11-6-5-7-12-23)19(28-17)16(24)10-13-31(2,3)4/h10,13,15-17,19-22,24H,5-9,11-12,14H2,1-4H3/b13-10+/t15-,16?,17+,19+,20+,21-,22+/m1/s1 |
| InChIKey | BSHVAIKUWAPZSA-YUILFLNBSA-N |
| XLogP | 3.10 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|