About (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol
(7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol (PubChem CID 71164677) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol.
Molecular Properties
| Compound Name | (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol |
| PubChem CID | 71164677 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol |
| SMILES | COc1ccc2c(c1Cl)OCC2CO |
| InChI | InChI=1S/C10H11ClO3/c1-13-8-3-2-7-6(4-12)5-14-10(7)9(8)11/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | LTJMRDCHRXJUFR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol?
The IUPAC name of (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol (CID 71164677) is (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol.
What is the SMILES notation for (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol?
The canonical SMILES for (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol is COc1ccc2c(c1Cl)OCC2CO.
What is the InChIKey of (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol?
The InChIKey is LTJMRDCHRXJUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-13-8-3-2-7-6(4-12)5-14-10(7)9(8)11/h2-3,6,12H,4-5H2,1H3.
What are the key properties of (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol?
(7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol has a molecular weight of 214.65 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanol is sourced from PubChem (CID 71164677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).