C29H34N4O11 — CID 71164836
(4R)-5-[[(2S)-1-[[3-(2,6-dimethylbenzoyl)oxy-2-oxopropyl]amino]-1-oxobutan-2-yl]amino]-4-[[2-(4-hydroxy-3-nitrophenyl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 71164836) has the molecular formula C29H34N4O11 and a molecular weight of 614.61 g/mol. Its IUPAC name is (4R)-5-[[(2S)-1-[[3-(2,6-dimethylbenzoyl)oxy-2-oxopropyl]amino]-1-oxobutan-2-yl]amino]-4-[[2-(4-hydroxy-3-nitrophenyl)acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (4R)-5-[[(2S)-1-[[3-(2,6-dimethylbenzoyl)oxy-2-oxopropyl]amino]-1-oxobutan-2-yl]amino]-4-[[2-(4-hydroxy-3-nitrophenyl)acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71164836 |
| Molecular Formula | C29H34N4O11 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | (4R)-5-[[(2S)-1-[[3-(2,6-dimethylbenzoyl)oxy-2-oxopropyl]amino]-1-oxobutan-2-yl]amino]-4-[[2-(4-hydroxy-3-nitrophenyl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)NCC(=O)COC(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C29H34N4O11/c1-4-20(27(39)30-14-19(34)15-44-29(41)26-16(2)6-5-7-17(26)3)32-28(40)21(9-11-25(37)38)31-24(36)13-18-8-10-23(35)22(12-18)33(42)43/h5-8,10,12,20-21,35H,4,9,11,13-15H2,1-3H3,(H,30,39)(H,31,36)(H,32,40)(H,37,38)/t20-,21+/m0/s1 |
| InChIKey | XHYDMSOXXWSAJC-LEWJYISDSA-N |
| XLogP | 1.25 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|