C20H25FN6O — CID 71164915
6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 71164915) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 71164915 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | N[C@H]1CCCC[C@H]1Nc1nc(-c2cc3n(c2)CCNC3)c2c(c1F)CNC2=O |
| InChI | InChI=1S/C20H25FN6O/c21-17-13-9-24-20(28)16(13)18(11-7-12-8-23-5-6-27(12)10-11)26-19(17)25-15-4-2-1-3-14(15)22/h7,10,14-15,23H,1-6,8-9,22H2,(H,24,28)(H,25,26)/t14-,15+/m0/s1 |
| InChIKey | CDOCWXKICXPYQF-LSDHHAIUSA-N |
| XLogP | 1.72 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |