C20H11F2NO2 — CID 71165295
4,15-difluoro-17-methoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene (PubChem CID 71165295) has the molecular formula C20H11F2NO2 and a molecular weight of 335.31 g/mol. Its IUPAC name is 4,15-difluoro-17-methoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene.
| Compound Name | 4,15-difluoro-17-methoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene |
|---|---|
| PubChem CID | 71165295 |
| Molecular Formula | C20H11F2NO2 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4,15-difluoro-17-methoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene |
| SMILES | COc1cc(F)c2c(c1)nc1c3c(cccc32)Oc2ccc(F)cc2-1 |
| InChI | InChI=1S/C20H11F2NO2/c1-24-11-8-14(22)18-12-3-2-4-17-19(12)20(23-15(18)9-11)13-7-10(21)5-6-16(13)25-17/h2-9H,1H3 |
| InChIKey | PJJMGZPRJFYTGU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|