C24H14F2N3O+ — CID 71165302
4,15-difluoro-20-methyl-17-pyrimidin-5-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene (PubChem CID 71165302) has the molecular formula C24H14F2N3O+ and a molecular weight of 398.39 g/mol. Its IUPAC name is 4,15-difluoro-20-methyl-17-pyrimidin-5-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene.
| Compound Name | 4,15-difluoro-20-methyl-17-pyrimidin-5-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene |
|---|---|
| PubChem CID | 71165302 |
| Molecular Formula | C24H14F2N3O+ |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4,15-difluoro-20-methyl-17-pyrimidin-5-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14(19),15,17-decaene |
| SMILES | C[n+]1c2c3c(cccc3c3c(F)cc(-c4cncnc4)cc31)Oc1ccc(F)cc1-2 |
| InChI | InChI=1S/C24H14F2N3O/c1-29-19-8-13(14-10-27-12-28-11-14)7-18(26)22(19)16-3-2-4-21-23(16)24(29)17-9-15(25)5-6-20(17)30-21/h2-12H,1H3/q+1 |
| InChIKey | OJDVDYGDJZDBKK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|