C15H24FN — CID 71165840
(3S,5R)-5-[(1R,5R)-5-fluorocyclohex-2-en-1-yl]-2-methyl-3-[(Z)-prop-1-enyl]piperidine (PubChem CID 71165840) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is (3S,5R)-5-[(1R,5R)-5-fluorocyclohex-2-en-1-yl]-2-methyl-3-[(Z)-prop-1-enyl]piperidine.
| Compound Name | (3S,5R)-5-[(1R,5R)-5-fluorocyclohex-2-en-1-yl]-2-methyl-3-[(Z)-prop-1-enyl]piperidine |
|---|---|
| PubChem CID | 71165840 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (3S,5R)-5-[(1R,5R)-5-fluorocyclohex-2-en-1-yl]-2-methyl-3-[(Z)-prop-1-enyl]piperidine |
| SMILES | C/C=C\[C@@H]1C[C@H]([C@H]2C=CC[C@@H](F)C2)CNC1C |
| InChI | InChI=1S/C15H24FN/c1-3-5-12-8-14(10-17-11(12)2)13-6-4-7-15(16)9-13/h3-6,11-15,17H,7-10H2,1-2H3/b5-3-/t11?,12-,13+,14+,15-/m1/s1 |
| InChIKey | FZWNGFJKWLASDJ-SVRXJUAWSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|