About N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide
N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide (PubChem CID 71166315) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide.
Molecular Properties
| Compound Name | N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide |
| PubChem CID | 71166315 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide |
| SMILES | CC(=O)NC12CC3CCC(N)C(C1)C(C3)C2 |
| InChI | InChI=1S/C13H22N2O/c1-8(16)15-13-5-9-2-3-12(14)11(7-13)10(4-9)6-13/h9-12H,2-7,14H2,1H3,(H,15,16) |
| InChIKey | XLQPTPLSTLFPMV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide?
The IUPAC name of N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide (CID 71166315) is N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide.
What is the SMILES notation for N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide?
The canonical SMILES for N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide is CC(=O)NC12CC3CCC(N)C(C1)C(C3)C2.
What is the InChIKey of N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide?
The InChIKey is XLQPTPLSTLFPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-8(16)15-13-5-9-2-3-12(14)11(7-13)10(4-9)6-13/h9-12H,2-7,14H2,1H3,(H,15,16).
What are the key properties of N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide?
N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide has a molecular weight of 222.33 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1-tricyclo[5.3.1.03,9]undecanyl)acetamide is sourced from PubChem (CID 71166315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).