C45H52O12 — CID 71166597
[(3R,6R)-5-acetyloxy-6-[(3R,4R,6R)-2-(hydroxymethyl)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 71166597) has the molecular formula C45H52O12 and a molecular weight of 784.90 g/mol. Its IUPAC name is [(3R,6R)-5-acetyloxy-6-[(3R,4R,6R)-2-(hydroxymethyl)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(3R,6R)-5-acetyloxy-6-[(3R,4R,6R)-2-(hydroxymethyl)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 71166597 |
| Molecular Formula | C45H52O12 |
| Molecular Weight | 784.90 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | [(3R,6R)-5-acetyloxy-6-[(3R,4R,6R)-2-(hydroxymethyl)-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OCc2ccccc2)[C@H](OC(C)=O)C(COCc2ccccc2)O[C@@H]1O[C@@H]1C(OCc2ccccc2)[C@@H](C)OC(CO)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H52O12/c1-30-39(50-26-34-18-10-5-11-19-34)43(40(37(24-46)53-30)51-27-35-20-12-6-13-21-35)57-45-44(55-32(3)48)42(52-28-36-22-14-7-15-23-36)41(54-31(2)47)38(56-45)29-49-25-33-16-8-4-9-17-33/h4-23,30,37-46H,24-29H2,1-3H3/t30-,37?,38?,39?,40-,41-,42?,43-,44?,45-/m1/s1 |
| InChIKey | WPIULNUKGWBTAW-YHJITCESSA-N |
| XLogP | 5.71 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |