About (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane
(2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane (PubChem CID 71166647) has the molecular formula C17H34O3S
and a molecular weight of 318.52 g/mol. Its IUPAC name is (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane.
Molecular Properties
| Compound Name | (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane |
| PubChem CID | 71166647 |
| Molecular Formula | C17H34O3S |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane |
| SMILES | CCCCOC[C@@H]1SC[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C17H34O3S/c1-4-7-10-18-13-16-17(20-12-9-6-3)15(14-21-16)19-11-8-5-2/h15-17H,4-14H2,1-3H3/t15-,16+,17?/m1/s1 |
| InChIKey | SKRXUGPCRVCKME-GARXDOFDSA-N |
| XLogP | 4.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane?
The IUPAC name of (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane (CID 71166647) is (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane.
What is the SMILES notation for (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane?
The canonical SMILES for (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane is CCCCOC[C@@H]1SC[C@@H](OCCCC)C1OCCCC.
What is the InChIKey of (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane?
The InChIKey is SKRXUGPCRVCKME-GARXDOFDSA-N. The full InChI is InChI=1S/C17H34O3S/c1-4-7-10-18-13-16-17(20-12-9-6-3)15(14-21-16)19-11-8-5-2/h15-17H,4-14H2,1-3H3/t15-,16+,17?/m1/s1.
What are the key properties of (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane?
(2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane has a molecular weight of 318.52 g/mol, XLogP of 4.29, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane is sourced from PubChem (CID 71166647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).