C17H34O3S — CID 71166661
(2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane (PubChem CID 71166661) has the molecular formula C17H34O3S and a molecular weight of 318.52 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane.
| Compound Name | (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane |
|---|---|
| PubChem CID | 71166661 |
| Molecular Formula | C17H34O3S |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3R,4S)-3,4-dibutoxy-2-(butoxymethyl)thiolane |
| SMILES | CCCCOC[C@H]1SC[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C17H34O3S/c1-4-7-10-18-13-16-17(20-12-9-6-3)15(14-21-16)19-11-8-5-2/h15-17H,4-14H2,1-3H3/t15-,16-,17-/m1/s1 |
| InChIKey | SKRXUGPCRVCKME-BRWVUGGUSA-N |
| XLogP | 4.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|