About 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate
4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate (PubChem CID 7116668) has the molecular formula C11H14N3O3S-
and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate |
| PubChem CID | 7116668 |
| Molecular Formula | C11H14N3O3S- |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate |
| SMILES | Nc1c(C(=O)NC2CCCCC2)nsc1C(=O)[O-] |
| InChI | InChI=1S/C11H15N3O3S/c12-7-8(14-18-9(7)11(16)17)10(15)13-6-4-2-1-3-5-6/h6H,1-5,12H2,(H,13,15)(H,16,17)/p-1 |
| InChIKey | YRNSAQYTHAZUDK-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate?
The IUPAC name of 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate (CID 7116668) is 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate.
What is the SMILES notation for 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate?
The canonical SMILES for 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate is Nc1c(C(=O)NC2CCCCC2)nsc1C(=O)[O-].
What is the InChIKey of 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate?
The InChIKey is YRNSAQYTHAZUDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15N3O3S/c12-7-8(14-18-9(7)11(16)17)10(15)13-6-4-2-1-3-5-6/h6H,1-5,12H2,(H,13,15)(H,16,17)/p-1.
What are the key properties of 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate?
4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate has a molecular weight of 268.32 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(cyclohexylcarbamoyl)-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 7116668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).