C21H18ClN7 — CID 71167352
3-[4-[[6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethylanilino]propanenitrile (PubChem CID 71167352) has the molecular formula C21H18ClN7 and a molecular weight of 403.88 g/mol. Its IUPAC name is 3-[4-[[6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethylanilino]propanenitrile.
| Compound Name | 3-[4-[[6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethylanilino]propanenitrile |
|---|---|
| PubChem CID | 71167352 |
| Molecular Formula | C21H18ClN7 |
| Molecular Weight | 403.88 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 3-[4-[[6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/N=C2/C(c3ccccc3Cl)=Nn3ncnc32)cc1 |
| InChI | InChI=1S/C21H18ClN7/c1-2-28(13-5-12-23)16-10-8-15(9-11-16)26-20-19(17-6-3-4-7-18(17)22)27-29-21(20)24-14-25-29/h3-4,6-11,14H,2,5,13H2,1H3/b26-20- |
| InChIKey | WYNSSUUBOHHHEP-QOMWVZHYSA-N |
| XLogP | 4.06 |
| TPSA | 82.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|