C20H26O6S — CID 71167537
[(4S,7S,7aR)-6-(butoxymethyl)-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-7-yl] acetate (PubChem CID 71167537) has the molecular formula C20H26O6S and a molecular weight of 394.49 g/mol. Its IUPAC name is [(4S,7S,7aR)-6-(butoxymethyl)-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-7-yl] acetate.
| Compound Name | [(4S,7S,7aR)-6-(butoxymethyl)-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 71167537 |
| Molecular Formula | C20H26O6S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(4S,7S,7aR)-6-(butoxymethyl)-2-oxo-4-phenylsulfanyl-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-7-yl] acetate |
| SMILES | CCCCOCC1O[C@@H](Sc2ccccc2)C2CC(=O)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H26O6S/c1-3-4-10-23-12-16-19(24-13(2)21)18-15(11-17(22)26-18)20(25-16)27-14-8-6-5-7-9-14/h5-9,15-16,18-20H,3-4,10-12H2,1-2H3/t15?,16?,18-,19-,20+/m1/s1 |
| InChIKey | QBUHAMZWUYGXNG-XZJNCXDESA-N |
| XLogP | 3.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|