C21H20O5S — CID 71167550
(1S,2R,7S)-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 71167550) has the molecular formula C21H20O5S and a molecular weight of 384.45 g/mol. Its IUPAC name is (1S,2R,7S)-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,7S)-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 71167550 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (1S,2R,7S)-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | O=C1CC2[C@@H](O1)[C@@H]1OC(c3ccccc3)OCC1O[C@H]2Sc1ccccc1 |
| InChI | InChI=1S/C21H20O5S/c22-17-11-15-18(25-17)19-16(24-21(15)27-14-9-5-2-6-10-14)12-23-20(26-19)13-7-3-1-4-8-13/h1-10,15-16,18-21H,11-12H2/t15?,16?,18-,19-,20?,21+/m1/s1 |
| InChIKey | XLMSOMOUTLTFCD-WPRGCQQBSA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |