C24H39N3O — CID 71167666
N-[(1S)-1'-(3,3-dimethylbutyl)spiro[1,2,4,5-tetrahydroindene-3,4'-piperidine]-1-yl]pyrrolidine-1-carboxamide (PubChem CID 71167666) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is N-[(1S)-1'-(3,3-dimethylbutyl)spiro[1,2,4,5-tetrahydroindene-3,4'-piperidine]-1-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(1S)-1'-(3,3-dimethylbutyl)spiro[1,2,4,5-tetrahydroindene-3,4'-piperidine]-1-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71167666 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | N-[(1S)-1'-(3,3-dimethylbutyl)spiro[1,2,4,5-tetrahydroindene-3,4'-piperidine]-1-yl]pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)CCN1CCC2(CC1)C[C@H](NC(=O)N1CCCC1)C1=C2CCC=C1 |
| InChI | InChI=1S/C24H39N3O/c1-23(2,3)10-15-26-16-11-24(12-17-26)18-21(19-8-4-5-9-20(19)24)25-22(28)27-13-6-7-14-27/h4,8,21H,5-7,9-18H2,1-3H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | VCYAOXQVFAKQFD-NRFANRHFSA-N |
| XLogP | 4.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |