(2,5-difluorophenyl)-iodoborinic acid

C6H4BF2IO — CID 71167672

IUPAC(2,5-difluorophenyl)-iodoborinic acid
SMILESOB(I)c1cc(F)ccc1F
InChIInChI=1S/C6H4BF2IO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,11H
InChIKeyFVULLFYKVNBYKK-UHFFFAOYSA-N
MW267.81 g/mol
LogP1.09
Rot. Bonds1

About (2,5-difluorophenyl)-iodoborinic acid

(2,5-difluorophenyl)-iodoborinic acid (PubChem CID 71167672) has the molecular formula C6H4BF2IO and a molecular weight of 267.81 g/mol. Its IUPAC name is (2,5-difluorophenyl)-iodoborinic acid.

Molecular Properties

Compound Name(2,5-difluorophenyl)-iodoborinic acid
PubChem CID71167672
Molecular FormulaC6H4BF2IO
Molecular Weight267.81 g/mol
Exact Mass267.94
IUPAC Name(2,5-difluorophenyl)-iodoborinic acid
SMILESOB(I)c1cc(F)ccc1F
InChIInChI=1S/C6H4BF2IO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,11H
InChIKeyFVULLFYKVNBYKK-UHFFFAOYSA-N
XLogP1.09
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.81
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze (2,5-difluorophenyl)-iodoborinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-difluorophenyl)-iodoborinic acid?
The IUPAC name of (2,5-difluorophenyl)-iodoborinic acid (CID 71167672) is (2,5-difluorophenyl)-iodoborinic acid.
What is the SMILES notation for (2,5-difluorophenyl)-iodoborinic acid?
The canonical SMILES for (2,5-difluorophenyl)-iodoborinic acid is OB(I)c1cc(F)ccc1F.
What is the InChIKey of (2,5-difluorophenyl)-iodoborinic acid?
The InChIKey is FVULLFYKVNBYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BF2IO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,11H.
What are the key properties of (2,5-difluorophenyl)-iodoborinic acid?
(2,5-difluorophenyl)-iodoborinic acid has a molecular weight of 267.81 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-difluorophenyl)-iodoborinic acid is sourced from PubChem (CID 71167672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).