About N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine
N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine (PubChem CID 71168011) has the molecular formula C14H20FN3
and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine |
| PubChem CID | 71168011 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine |
| SMILES | Cc1cncn1CCCNCC1=CCC(F)C=C1 |
| InChI | InChI=1S/C14H20FN3/c1-12-9-17-11-18(12)8-2-7-16-10-13-3-5-14(15)6-4-13/h3-5,9,11,14,16H,2,6-8,10H2,1H3 |
| InChIKey | ARFMDKKWWXWMJG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine?
The IUPAC name of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine (CID 71168011) is N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine.
What is the SMILES notation for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine?
The canonical SMILES for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine is Cc1cncn1CCCNCC1=CCC(F)C=C1.
What is the InChIKey of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine?
The InChIKey is ARFMDKKWWXWMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FN3/c1-12-9-17-11-18(12)8-2-7-16-10-13-3-5-14(15)6-4-13/h3-5,9,11,14,16H,2,6-8,10H2,1H3.
What are the key properties of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine?
N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine has a molecular weight of 249.33 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-(5-methylimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 71168011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).