About N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine (PubChem CID 71168015) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine |
| PubChem CID | 71168015 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine |
| SMILES | Cc1cncn1CCCNCC1=CCCC=C1 |
| InChI | InChI=1S/C14H21N3/c1-13-10-16-12-17(13)9-5-8-15-11-14-6-3-2-4-7-14/h3,6-7,10,12,15H,2,4-5,8-9,11H2,1H3 |
| InChIKey | OCZZAEFDHPGKLC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine (CID 71168015) is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine is Cc1cncn1CCCNCC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine?
The InChIKey is OCZZAEFDHPGKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-13-10-16-12-17(13)9-5-8-15-11-14-6-3-2-4-7-14/h3,6-7,10,12,15H,2,4-5,8-9,11H2,1H3.
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine?
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine has a molecular weight of 231.34 g/mol, XLogP of 2.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-(5-methylimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 71168015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).