C20H34O3 — CID 71168128
5-ethyl-6-(3-hydroxy-2,2-dimethylcyclopentyl)-4a-(hydroxymethyl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol (PubChem CID 71168128) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 5-ethyl-6-(3-hydroxy-2,2-dimethylcyclopentyl)-4a-(hydroxymethyl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol.
| Compound Name | 5-ethyl-6-(3-hydroxy-2,2-dimethylcyclopentyl)-4a-(hydroxymethyl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 71168128 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 5-ethyl-6-(3-hydroxy-2,2-dimethylcyclopentyl)-4a-(hydroxymethyl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
| SMILES | CCC1C(C2CCC(O)C2(C)C)CC=C2CC(O)CCC21CO |
| InChI | InChI=1S/C20H34O3/c1-4-16-15(17-7-8-18(23)19(17,2)3)6-5-13-11-14(22)9-10-20(13,16)12-21/h5,14-18,21-23H,4,6-12H2,1-3H3 |
| InChIKey | IALHCWNZSWTUPB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|