About [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone
[2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone (PubChem CID 71168161) has the molecular formula C27H18Br2N2O
and a molecular weight of 546.26 g/mol. Its IUPAC name is [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone.
Molecular Properties
| Compound Name | [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone |
| PubChem CID | 71168161 |
| Molecular Formula | C27H18Br2N2O |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)nc2c1)C1C=CC=CC1 |
| InChI | InChI=1S/C27H18Br2N2O/c28-21-11-6-17(7-12-21)25-26(18-8-13-22(29)14-9-18)31-24-16-20(10-15-23(24)30-25)27(32)19-4-2-1-3-5-19/h1-4,6-16,19H,5H2 |
| InChIKey | RCUPBUUEXUHPMD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone?
The IUPAC name of [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone (CID 71168161) is [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone.
What is the SMILES notation for [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone?
The canonical SMILES for [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone is O=C(c1ccc2nc(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)nc2c1)C1C=CC=CC1.
What is the InChIKey of [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone?
The InChIKey is RCUPBUUEXUHPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18Br2N2O/c28-21-11-6-17(7-12-21)25-26(18-8-13-22(29)14-9-18)31-24-16-20(10-15-23(24)30-25)27(32)19-4-2-1-3-5-19/h1-4,6-16,19H,5H2.
What are the key properties of [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone?
[2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone has a molecular weight of 546.26 g/mol, XLogP of 7.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(4-bromophenyl)quinoxalin-6-yl]-cyclohexa-2,4-dien-1-ylmethanone is sourced from PubChem (CID 71168161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).