C9H12F3NOS2 — CID 71168196
2-(2-ethylsulfanyl-1,3-thiazol-5-yl)-1,1,1-trifluorobutan-2-ol (PubChem CID 71168196) has the molecular formula C9H12F3NOS2 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-(2-ethylsulfanyl-1,3-thiazol-5-yl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 2-(2-ethylsulfanyl-1,3-thiazol-5-yl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 71168196 |
| Molecular Formula | C9H12F3NOS2 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-(2-ethylsulfanyl-1,3-thiazol-5-yl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CCSc1ncc(C(O)(CC)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H12F3NOS2/c1-3-8(14,9(10,11)12)6-5-13-7(16-6)15-4-2/h5,14H,3-4H2,1-2H3 |
| InChIKey | PEADODMHNRDPND-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|