C21H42O4Si2 — CID 71168205
cis-(3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one (PubChem CID 71168205) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is cis-(3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one.
| Compound Name | cis-(3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 71168205 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | cis-(3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one |
| SMILES | CC(C)(C[C@@H]1CC(=O)C[C@@H](O)C1=CCCO[Si](C)(C)C(C)(C)C)[Si](C)(C)O |
| InChI | InChI=1S/C21H42O4Si2/c1-20(2,3)27(8,9)25-12-10-11-18-16(13-17(22)14-19(18)23)15-21(4,5)26(6,7)24/h11,16,19,23-24H,10,12-15H2,1-9H3/t16-,19+/m0/s1 |
| InChIKey | LRSKYDAFZPCCIU-QFBILLFUSA-N |
| XLogP | 5.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|