C22H46O5Si2 — CID 71168206
(1S,3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-(hydroxymethyl)cyclohexane-1,3-diol (PubChem CID 71168206) has the molecular formula C22H46O5Si2 and a molecular weight of 446.78 g/mol. Its IUPAC name is (1S,3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-(hydroxymethyl)cyclohexane-1,3-diol.
| Compound Name | (1S,3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-(hydroxymethyl)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 71168206 |
| Molecular Formula | C22H46O5Si2 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (1S,3R,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-(hydroxymethyl)cyclohexane-1,3-diol |
| SMILES | CC(C)(C[C@@H]1C[C@@](O)(CO)C[C@@H](O)C1=CCCO[Si](C)(C)C(C)(C)C)[Si](C)(C)O |
| InChI | InChI=1S/C22H46O5Si2/c1-20(2,3)29(8,9)27-12-10-11-18-17(13-21(4,5)28(6,7)26)14-22(25,16-23)15-19(18)24/h11,17,19,23-26H,10,12-16H2,1-9H3/t17-,19-,22+/m1/s1 |
| InChIKey | XQJIUUFAZXMZIO-JUXOCIIHSA-N |
| XLogP | 4.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|