C25H24N2O4S — CID 71168337
ethyl 2-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoacetate (PubChem CID 71168337) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 2-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 71168337 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | ethyl 2-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1CSC(NC(=O)C2(C)CC3c4ccccc4C2c2ccccc23)=N1 |
| InChI | InChI=1S/C25H24N2O4S/c1-3-31-22(29)21(28)19-13-32-24(26-19)27-23(30)25(2)12-18-14-8-4-6-10-16(14)20(25)17-11-7-5-9-15(17)18/h4-11,18-20H,3,12-13H2,1-2H3,(H,26,27,30) |
| InChIKey | HZZSARCAVAGOPZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|