C15H19NO3S — CID 71168387
(3aR,7aS)-1-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 71168387) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 71168387 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3aR,7aS)-1-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C[C@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-11-6-8-13(9-7-11)20(18,19)16-14-5-3-2-4-12(14)10-15(16)17/h6-9,12,14H,2-5,10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | CXIXCVMXBGBWSE-OCCSQVGLSA-N |
| XLogP | 2.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |