C21H31F3N2O2 — CID 71168433
(3R)-3-amino-1-[2-(2-ethylbutoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 71168433) has the molecular formula C21H31F3N2O2 and a molecular weight of 400.49 g/mol. Its IUPAC name is (3R)-3-amino-1-[2-(2-ethylbutoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[2-(2-ethylbutoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 71168433 |
| Molecular Formula | C21H31F3N2O2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (3R)-3-amino-1-[2-(2-ethylbutoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CCC(CC)COCC1CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H31F3N2O2/c1-3-14(4-2)12-28-13-17-6-5-7-26(17)21(27)10-16(25)8-15-9-19(23)20(24)11-18(15)22/h9,11,14,16-17H,3-8,10,12-13,25H2,1-2H3/t16-,17?/m1/s1 |
| InChIKey | FQAPEAFSVUWTOM-TZHYSIJRSA-N |
| XLogP | 3.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|