C30H50F2O6 — CID 71169222
butyl 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate (PubChem CID 71169222) has the molecular formula C30H50F2O6 and a molecular weight of 544.72 g/mol. Its IUPAC name is butyl 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 71169222 |
| Molecular Formula | C30H50F2O6 |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | butyl 7-[(1R,2R,3R)-2-[(6S)-4,4-difluoro-6-methyl-3-oxooctyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCOC(=O)CCCCCC[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1CCC(=O)C(F)(F)C[C@@H](C)CC |
| InChI | InChI=1S/C30H50F2O6/c1-4-6-18-36-28(35)14-10-8-7-9-13-23-24(16-17-27(34)30(31,32)21-22(3)5-2)26(20-25(23)33)38-29-15-11-12-19-37-29/h22-24,26,29H,4-21H2,1-3H3/t22-,23+,24+,26+,29?/m0/s1 |
| InChIKey | TYELISJNDLZSHP-VKATWUCKSA-N |
| XLogP | 7.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|